C15H13F3N4O — CID 110430911
4-methyl-2-[[6-methyl-2-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenol (PubChem CID 110430911) has the molecular formula C15H13F3N4O and a molecular weight of 322.29 g/mol. Its IUPAC name is 4-methyl-2-[[6-methyl-2-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenol.
| Compound Name | 4-methyl-2-[[6-methyl-2-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 110430911 |
| Molecular Formula | C15H13F3N4O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-methyl-2-[[6-methyl-2-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenol |
| SMILES | Cc1ccc(O)c(Nc2nc(C(F)(F)F)nc3[nH]c(C)cc23)c1 |
| InChI | InChI=1S/C15H13F3N4O/c1-7-3-4-11(23)10(5-7)20-13-9-6-8(2)19-12(9)21-14(22-13)15(16,17)18/h3-6,23H,1-2H3,(H2,19,20,21,22) |
| InChIKey | ZCJJIXFHUKSSIV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|