About 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline
4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline (PubChem CID 11043205) has the molecular formula C14H25NOSi
and a molecular weight of 251.45 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline |
| PubChem CID | 11043205 |
| Molecular Formula | C14H25NOSi |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline |
| SMILES | Cc1cc(O[Si](C)(C)C(C)(C)C)cc(C)c1N |
| InChI | InChI=1S/C14H25NOSi/c1-10-8-12(9-11(2)13(10)15)16-17(6,7)14(3,4)5/h8-9H,15H2,1-7H3 |
| InChIKey | HIZVNOJAZWWIMK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline?
The IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline (CID 11043205) is 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline.
What is the SMILES notation for 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline?
The canonical SMILES for 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline is Cc1cc(O[Si](C)(C)C(C)(C)C)cc(C)c1N.
What is the InChIKey of 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline?
The InChIKey is HIZVNOJAZWWIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NOSi/c1-10-8-12(9-11(2)13(10)15)16-17(6,7)14(3,4)5/h8-9H,15H2,1-7H3.
What are the key properties of 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline?
4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline has a molecular weight of 251.45 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylaniline is sourced from PubChem (CID 11043205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).