C9H14ClNO5 — CID 11043207
(2R,3S,4R)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]pentane-1,2,3,4-tetrol (PubChem CID 11043207) has the molecular formula C9H14ClNO5 and a molecular weight of 251.67 g/mol. Its IUPAC name is (2R,3S,4R)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11043207 |
| Molecular Formula | C9H14ClNO5 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (2R,3S,4R)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)Cc1cc(CCl)on1 |
| InChI | InChI=1S/C9H14ClNO5/c10-3-6-1-5(11-16-6)2-7(13)9(15)8(14)4-12/h1,7-9,12-15H,2-4H2/t7-,8-,9+/m1/s1 |
| InChIKey | ZVMBHGZPMJMDSQ-HLTSFMKQSA-N |
| XLogP | -0.97 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|