C15H15FN6O — CID 110432089
N-[2-[[1-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 110432089) has the molecular formula C15H15FN6O and a molecular weight of 314.32 g/mol. Its IUPAC name is N-[2-[[1-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[1-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 110432089 |
| Molecular Formula | C15H15FN6O |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[2-[[1-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ncnc2c1cnn2-c1ccccc1F |
| InChI | InChI=1S/C15H15FN6O/c1-10(23)17-6-7-18-14-11-8-21-22(15(11)20-9-19-14)13-5-3-2-4-12(13)16/h2-5,8-9H,6-7H2,1H3,(H,17,23)(H,18,19,20) |
| InChIKey | NPOPKIMNAVMQPF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|