C15H16BrN5 — CID 110432149
1-(3-bromophenyl)-N-butylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 110432149) has the molecular formula C15H16BrN5 and a molecular weight of 346.23 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-butylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(3-bromophenyl)-N-butylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110432149 |
| Molecular Formula | C15H16BrN5 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 1-(3-bromophenyl)-N-butylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCNc1ncnc2c1cnn2-c1cccc(Br)c1 |
| InChI | InChI=1S/C15H16BrN5/c1-2-3-7-17-14-13-9-20-21(15(13)19-10-18-14)12-6-4-5-11(16)8-12/h4-6,8-10H,2-3,7H2,1H3,(H,17,18,19) |
| InChIKey | CMYWWWKCFSOTFK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|