C12H11BrN4OS — CID 110432304
12-bromo-N-(2-methoxyethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 110432304) has the molecular formula C12H11BrN4OS and a molecular weight of 339.22 g/mol. Its IUPAC name is 12-bromo-N-(2-methoxyethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 12-bromo-N-(2-methoxyethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 110432304 |
| Molecular Formula | C12H11BrN4OS |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 12-bromo-N-(2-methoxyethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | COCCNc1ncnc2c1sc1ncc(Br)cc12 |
| InChI | InChI=1S/C12H11BrN4OS/c1-18-3-2-14-11-10-9(16-6-17-11)8-4-7(13)5-15-12(8)19-10/h4-6H,2-3H2,1H3,(H,14,16,17) |
| InChIKey | ZZJGFPZOVXEOEJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|