C15H20N2O3 — CID 110432925
N-(2,2-dimethoxyethyl)-7-methoxy-2-methylquinolin-4-amine (PubChem CID 110432925) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-7-methoxy-2-methylquinolin-4-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-7-methoxy-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 110432925 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-7-methoxy-2-methylquinolin-4-amine |
| SMILES | COc1ccc2c(NCC(OC)OC)cc(C)nc2c1 |
| InChI | InChI=1S/C15H20N2O3/c1-10-7-13(16-9-15(19-3)20-4)12-6-5-11(18-2)8-14(12)17-10/h5-8,15H,9H2,1-4H3,(H,16,17) |
| InChIKey | AQOCLGVQFOGUTG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|