C16H18O3 — CID 11043442
trans-methyl (1R,5S)-1-acetyl-2-methylidene-5-phenylcyclopentane-1-carboxylate (PubChem CID 11043442) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is trans-methyl (1R,5S)-1-acetyl-2-methylidene-5-phenylcyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,5S)-1-acetyl-2-methylidene-5-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11043442 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | trans-methyl (1R,5S)-1-acetyl-2-methylidene-5-phenylcyclopentane-1-carboxylate |
| SMILES | C=C1CC[C@@H](c2ccccc2)[C@@]1(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C16H18O3/c1-11-9-10-14(13-7-5-4-6-8-13)16(11,12(2)17)15(18)19-3/h4-8,14H,1,9-10H2,2-3H3/t14-,16+/m0/s1 |
| InChIKey | VPSHAKPXSIDZRL-GOEBONIOSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|