About 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane
2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane (PubChem CID 11043458) has the molecular formula C15H30OS
and a molecular weight of 258.47 g/mol. Its IUPAC name is 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane |
| PubChem CID | 11043458 |
| Molecular Formula | C15H30OS |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane |
| SMILES | CC(C)CCCC(C)CCCC1(C)OCCS1 |
| InChI | InChI=1S/C15H30OS/c1-13(2)7-5-8-14(3)9-6-10-15(4)16-11-12-17-15/h13-14H,5-12H2,1-4H3 |
| InChIKey | VOTRTVTXAVZEOB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane?
The IUPAC name of 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane (CID 11043458) is 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane.
What is the SMILES notation for 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane?
The canonical SMILES for 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane is CC(C)CCCC(C)CCCC1(C)OCCS1.
What is the InChIKey of 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane?
The InChIKey is VOTRTVTXAVZEOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30OS/c1-13(2)7-5-8-14(3)9-6-10-15(4)16-11-12-17-15/h13-14H,5-12H2,1-4H3.
What are the key properties of 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane?
2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane has a molecular weight of 258.47 g/mol, XLogP of 5.10, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,8-dimethylnonyl)-2-methyl-1,3-oxathiolane is sourced from PubChem (CID 11043458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).