About 2-benzhydryloxyoxane
2-benzhydryloxyoxane (PubChem CID 11043774) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-benzhydryloxyoxane.
Molecular Properties
| Compound Name | 2-benzhydryloxyoxane |
| PubChem CID | 11043774 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-benzhydryloxyoxane |
| SMILES | c1ccc(C(OC2CCCCO2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20O2/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)20-17-13-7-8-14-19-17/h1-6,9-12,17-18H,7-8,13-14H2 |
| InChIKey | YXGWESUPDNZCQM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzhydryloxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryloxyoxane?
The IUPAC name of 2-benzhydryloxyoxane (CID 11043774) is 2-benzhydryloxyoxane.
What is the SMILES notation for 2-benzhydryloxyoxane?
The canonical SMILES for 2-benzhydryloxyoxane is c1ccc(C(OC2CCCCO2)c2ccccc2)cc1.
What is the InChIKey of 2-benzhydryloxyoxane?
The InChIKey is YXGWESUPDNZCQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)20-17-13-7-8-14-19-17/h1-6,9-12,17-18H,7-8,13-14H2.
What are the key properties of 2-benzhydryloxyoxane?
2-benzhydryloxyoxane has a molecular weight of 268.36 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryloxyoxane is sourced from PubChem (CID 11043774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).