C10H5F6NO — CID 11043788
N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)benzamide (PubChem CID 11043788) has the molecular formula C10H5F6NO and a molecular weight of 269.14 g/mol. Its IUPAC name is N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)benzamide.
| Compound Name | N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)benzamide |
|---|---|
| PubChem CID | 11043788 |
| Molecular Formula | C10H5F6NO |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | N-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)benzamide |
| SMILES | O=C(N=C(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H5F6NO/c11-9(12,13)8(10(14,15)16)17-7(18)6-4-2-1-3-5-6/h1-5H |
| InChIKey | AMQLAPGCCRQSTO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|