C14H22O5 — CID 11043822
(1R,3S,5R,7S,8R,10S,12R,14S)-14-ethoxy-4,11,15-trioxatetracyclo[6.6.1.03,5.010,12]pentadecan-7-ol (PubChem CID 11043822) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (1R,3S,5R,7S,8R,10S,12R,14S)-14-ethoxy-4,11,15-trioxatetracyclo[6.6.1.03,5.010,12]pentadecan-7-ol.
| Compound Name | (1R,3S,5R,7S,8R,10S,12R,14S)-14-ethoxy-4,11,15-trioxatetracyclo[6.6.1.03,5.010,12]pentadecan-7-ol |
|---|---|
| PubChem CID | 11043822 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (1R,3S,5R,7S,8R,10S,12R,14S)-14-ethoxy-4,11,15-trioxatetracyclo[6.6.1.03,5.010,12]pentadecan-7-ol |
| SMILES | CCO[C@H]1C[C@H]2O[C@H]2C[C@H]2O[C@@H]1C[C@@H]1O[C@@H]1C[C@@H]2O |
| InChI | InChI=1S/C14H22O5/c1-2-16-9-5-13-12(19-13)4-8-7(15)3-10-14(18-10)6-11(9)17-8/h7-15H,2-6H2,1H3/t7-,8+,9-,10+,11+,12-,13+,14-/m0/s1 |
| InChIKey | YRFXCSQZRPTBDR-GHKKJFFVSA-N |
| XLogP | 0.63 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|