C17H17NO4S — CID 110439305
N-(4-acetylphenyl)-2-(2-methylsulfonylphenyl)acetamide (PubChem CID 110439305) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(2-methylsulfonylphenyl)acetamide.
| Compound Name | N-(4-acetylphenyl)-2-(2-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 110439305 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-(4-acetylphenyl)-2-(2-methylsulfonylphenyl)acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)Cc2ccccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17NO4S/c1-12(19)13-7-9-15(10-8-13)18-17(20)11-14-5-3-4-6-16(14)23(2,21)22/h3-10H,11H2,1-2H3,(H,18,20) |
| InChIKey | MQHYQEMHONAFIG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |