C10H13IO — CID 11044027
(1E,3E,5R)-1-iodo-5-methoxy-2-methylocta-1,3-dien-7-yne (PubChem CID 11044027) has the molecular formula C10H13IO and a molecular weight of 276.12 g/mol. Its IUPAC name is (1E,3E,5R)-1-iodo-5-methoxy-2-methylocta-1,3-dien-7-yne.
| Compound Name | (1E,3E,5R)-1-iodo-5-methoxy-2-methylocta-1,3-dien-7-yne |
|---|---|
| PubChem CID | 11044027 |
| Molecular Formula | C10H13IO |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | (1E,3E,5R)-1-iodo-5-methoxy-2-methylocta-1,3-dien-7-yne |
| SMILES | C#CC[C@H](/C=C/C(C)=C/I)OC |
| InChI | InChI=1S/C10H13IO/c1-4-5-10(12-3)7-6-9(2)8-11/h1,6-8,10H,5H2,2-3H3/b7-6+,9-8+/t10-/m1/s1 |
| InChIKey | RXPPSAANOPIZKO-JETOPDJTSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|