C18H16N2O3 — CID 110440706
N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)chromene-3-carboxamide (PubChem CID 110440706) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)chromene-3-carboxamide.
| Compound Name | N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 110440706 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)chromene-3-carboxamide |
| SMILES | CN(CCc1ccncc1)C(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C18H16N2O3/c1-20(11-8-13-6-9-19-10-7-13)17(21)15-12-14-4-2-3-5-16(14)23-18(15)22/h2-7,9-10,12H,8,11H2,1H3 |
| InChIKey | FVRDMWLQEWNNFC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|