C16H12Cl3NO — CID 110440796
2,5-dichloro-N-[1-(3-chlorophenyl)cyclopropyl]benzamide (PubChem CID 110440796) has the molecular formula C16H12Cl3NO and a molecular weight of 340.64 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(3-chlorophenyl)cyclopropyl]benzamide.
| Compound Name | 2,5-dichloro-N-[1-(3-chlorophenyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 110440796 |
| Molecular Formula | C16H12Cl3NO |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2,5-dichloro-N-[1-(3-chlorophenyl)cyclopropyl]benzamide |
| SMILES | O=C(NC1(c2cccc(Cl)c2)CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H12Cl3NO/c17-11-3-1-2-10(8-11)16(6-7-16)20-15(21)13-9-12(18)4-5-14(13)19/h1-5,8-9H,6-7H2,(H,20,21) |
| InChIKey | YURAJCZWXIQANB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |