C16H13F3O — CID 11044091
(E)-1,1,1-trifluoro-2,4-diphenylbut-3-en-2-ol (PubChem CID 11044091) has the molecular formula C16H13F3O and a molecular weight of 278.27 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-2,4-diphenylbut-3-en-2-ol.
| Compound Name | (E)-1,1,1-trifluoro-2,4-diphenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 11044091 |
| Molecular Formula | C16H13F3O |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (E)-1,1,1-trifluoro-2,4-diphenylbut-3-en-2-ol |
| SMILES | OC(/C=C/c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H13F3O/c17-16(18,19)15(20,14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12,20H/b12-11+ |
| InChIKey | LUHFXZAAVMXXMR-VAWYXSNFSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |