C18H22N2OS — CID 110441727
N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]cyclohexanecarboxamide (PubChem CID 110441727) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110441727 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCc1nc(-c2ccccc2)cs1)C1CCCCC1 |
| InChI | InChI=1S/C18H22N2OS/c21-18(15-9-5-2-6-10-15)19-12-11-17-20-16(13-22-17)14-7-3-1-4-8-14/h1,3-4,7-8,13,15H,2,5-6,9-12H2,(H,19,21) |
| InChIKey | VIMAXRYPXJSCPO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |