C20H26O — CID 11044251
(1S,7S)-8-[[(1R,7R)-8-tricyclo[5.2.1.02,6]dec-3-enyl]oxy]tricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 11044251) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is (1S,7S)-8-[[(1R,7R)-8-tricyclo[5.2.1.02,6]dec-3-enyl]oxy]tricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | (1S,7S)-8-[[(1R,7R)-8-tricyclo[5.2.1.02,6]dec-3-enyl]oxy]tricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 11044251 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (1S,7S)-8-[[(1R,7R)-8-tricyclo[5.2.1.02,6]dec-3-enyl]oxy]tricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | C1=CC2C(C1)[C@@H]1C[C@H]2CC1OC1C[C@H]2C[C@@H]1C1CC=CC12 |
| InChI | InChI=1S/C20H26O/c1-3-13-11-7-17(15(13)5-1)19(9-11)21-20-10-12-8-18(20)16-6-2-4-14(12)16/h1-4,11-20H,5-10H2/t11-,12+,13?,14?,15?,16?,17-,18+,19?,20? |
| InChIKey | MROUMZRJDLDDEN-LLSNOEJOSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|