C13H6F5NO — CID 11044378
(NE)-N-[[4-(2,3,4,5,6-pentafluorophenyl)phenyl]methylidene]hydroxylamine (PubChem CID 11044378) has the molecular formula C13H6F5NO and a molecular weight of 287.19 g/mol. Its IUPAC name is (NE)-N-[[4-(2,3,4,5,6-pentafluorophenyl)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-(2,3,4,5,6-pentafluorophenyl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 11044378 |
| Molecular Formula | C13H6F5NO |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | (NE)-N-[[4-(2,3,4,5,6-pentafluorophenyl)phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1ccc(-c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H6F5NO/c14-9-8(10(15)12(17)13(18)11(9)16)7-3-1-6(2-4-7)5-19-20/h1-5,20H/b19-5+ |
| InChIKey | KTDNGTITPRMBGE-PTXOJBNSSA-N |
| XLogP | 3.86 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|