C20H21N3O — CID 110444641
N-[(1-methylimidazol-2-yl)methyl]-3,3-diphenylpropanamide (PubChem CID 110444641) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)methyl]-3,3-diphenylpropanamide.
| Compound Name | N-[(1-methylimidazol-2-yl)methyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 110444641 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)methyl]-3,3-diphenylpropanamide |
| SMILES | Cn1ccnc1CNC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O/c1-23-13-12-21-19(23)15-22-20(24)14-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-13,18H,14-15H2,1H3,(H,22,24) |
| InChIKey | RABCJAGYUOHUMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |