C17H19FO3 — CID 11044468
(2E,4E,6E)-8-(4-fluoro-2-methylphenoxy)-3,7-dimethylocta-2,4,6-trienoic acid (PubChem CID 11044468) has the molecular formula C17H19FO3 and a molecular weight of 290.33 g/mol. Its IUPAC name is (2E,4E,6E)-8-(4-fluoro-2-methylphenoxy)-3,7-dimethylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-8-(4-fluoro-2-methylphenoxy)-3,7-dimethylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 11044468 |
| Molecular Formula | C17H19FO3 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2E,4E,6E)-8-(4-fluoro-2-methylphenoxy)-3,7-dimethylocta-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C(\C)COc1ccc(F)cc1C)=C\C(=O)O |
| InChI | InChI=1S/C17H19FO3/c1-12(9-17(19)20)5-4-6-13(2)11-21-16-8-7-15(18)10-14(16)3/h4-10H,11H2,1-3H3,(H,19,20)/b5-4+,12-9+,13-6+ |
| InChIKey | PMJNZLWSQZJNHJ-QPCGNHOSSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|