About 3-bromobutyl 4-methylbenzenesulfinate
3-bromobutyl 4-methylbenzenesulfinate (PubChem CID 11044496) has the molecular formula C11H15BrO2S
and a molecular weight of 291.21 g/mol. Its IUPAC name is 3-bromobutyl 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | 3-bromobutyl 4-methylbenzenesulfinate |
| PubChem CID | 11044496 |
| Molecular Formula | C11H15BrO2S |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 3-bromobutyl 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)OCCC(C)Br)cc1 |
| InChI | InChI=1S/C11H15BrO2S/c1-9-3-5-11(6-4-9)15(13)14-8-7-10(2)12/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | OIEASNWIIWWHBP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromobutyl 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromobutyl 4-methylbenzenesulfinate?
The IUPAC name of 3-bromobutyl 4-methylbenzenesulfinate (CID 11044496) is 3-bromobutyl 4-methylbenzenesulfinate.
What is the SMILES notation for 3-bromobutyl 4-methylbenzenesulfinate?
The canonical SMILES for 3-bromobutyl 4-methylbenzenesulfinate is Cc1ccc(S(=O)OCCC(C)Br)cc1.
What is the InChIKey of 3-bromobutyl 4-methylbenzenesulfinate?
The InChIKey is OIEASNWIIWWHBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO2S/c1-9-3-5-11(6-4-9)15(13)14-8-7-10(2)12/h3-6,10H,7-8H2,1-2H3.
What are the key properties of 3-bromobutyl 4-methylbenzenesulfinate?
3-bromobutyl 4-methylbenzenesulfinate has a molecular weight of 291.21 g/mol, XLogP of 3.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromobutyl 4-methylbenzenesulfinate is sourced from PubChem (CID 11044496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).