About N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide
N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 110445340) has the molecular formula C16H15N3OS
and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 110445340 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCc1nc(-c2ccccc2)cs1)c1ccc[nH]1 |
| InChI | InChI=1S/C16H15N3OS/c20-16(13-7-4-9-17-13)18-10-8-15-19-14(11-21-15)12-5-2-1-3-6-12/h1-7,9,11,17H,8,10H2,(H,18,20) |
| InChIKey | VEBLWVWVOPNEPF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide (CID 110445340) is N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide is O=C(NCCc1nc(-c2ccccc2)cs1)c1ccc[nH]1.
What is the InChIKey of N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide?
The InChIKey is VEBLWVWVOPNEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3OS/c20-16(13-7-4-9-17-13)18-10-8-15-19-14(11-21-15)12-5-2-1-3-6-12/h1-7,9,11,17H,8,10H2,(H,18,20).
What are the key properties of N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide?
N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide has a molecular weight of 297.38 g/mol, XLogP of 3.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 110445340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).