C20H24N2 — CID 11044549
N-methyl-1-[(15S,16S)-16-(methylaminomethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanamine (PubChem CID 11044549) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-methyl-1-[(15S,16S)-16-(methylaminomethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanamine.
| Compound Name | N-methyl-1-[(15S,16S)-16-(methylaminomethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanamine |
|---|---|
| PubChem CID | 11044549 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-methyl-1-[(15S,16S)-16-(methylaminomethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanamine |
| SMILES | CNC[C@H]1C2c3ccccc3C(c3ccccc32)[C@@H]1CNC |
| InChI | InChI=1S/C20H24N2/c1-21-11-17-18(12-22-2)20-15-9-5-3-7-13(15)19(17)14-8-4-6-10-16(14)20/h3-10,17-22H,11-12H2,1-2H3/t17-,18-,19?,20?/m1/s1 |
| InChIKey | YEFDAVPFIOCQOE-UVHRUJRTSA-N |
| XLogP | 2.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |