C11H17BrO4 — CID 11044560
ethyl (E)-3-[(4R,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11044560) has the molecular formula C11H17BrO4 and a molecular weight of 293.16 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11044560 |
| Molecular Formula | C11H17BrO4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | ethyl (E)-3-[(4R,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1OC(C)(C)O[C@H]1CBr |
| InChI | InChI=1S/C11H17BrO4/c1-4-14-10(13)6-5-8-9(7-12)16-11(2,3)15-8/h5-6,8-9H,4,7H2,1-3H3/b6-5+/t8-,9+/m1/s1 |
| InChIKey | WKVAHZKCSCVISP-RKWMXMRGSA-N |
| XLogP | 2.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|