About diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate
diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate (PubChem CID 11044569) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate |
| PubChem CID | 11044569 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate |
| SMILES | CCCc1c(C(=O)OCC)c(C)nc(C)c1C(=O)OCC |
| InChI | InChI=1S/C16H23NO4/c1-6-9-12-13(15(18)20-7-2)10(4)17-11(5)14(12)16(19)21-8-3/h6-9H2,1-5H3 |
| InChIKey | ZRYFDBNDGXKORS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate (CID 11044569) is diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate is CCCc1c(C(=O)OCC)c(C)nc(C)c1C(=O)OCC.
What is the InChIKey of diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate?
The InChIKey is ZRYFDBNDGXKORS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-6-9-12-13(15(18)20-7-2)10(4)17-11(5)14(12)16(19)21-8-3/h6-9H2,1-5H3.
What are the key properties of diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate?
diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate has a molecular weight of 293.36 g/mol, XLogP of 3.00, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,6-dimethyl-4-propylpyridine-3,5-dicarboxylate is sourced from PubChem (CID 11044569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).