C13H16N2O4S — CID 11044662
(1S,2R,3S,4R,5R)-2,3,4-trihydroxy-N-phenyl-6-oxa-8-azabicyclo[3.2.1]octane-8-carbothioamide (PubChem CID 11044662) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R)-2,3,4-trihydroxy-N-phenyl-6-oxa-8-azabicyclo[3.2.1]octane-8-carbothioamide.
| Compound Name | (1S,2R,3S,4R,5R)-2,3,4-trihydroxy-N-phenyl-6-oxa-8-azabicyclo[3.2.1]octane-8-carbothioamide |
|---|---|
| PubChem CID | 11044662 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (1S,2R,3S,4R,5R)-2,3,4-trihydroxy-N-phenyl-6-oxa-8-azabicyclo[3.2.1]octane-8-carbothioamide |
| SMILES | O[C@@H]1[C@@H](O)[C@H]2OC[C@@H]([C@H]1O)N2C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C13H16N2O4S/c16-9-8-6-19-12(11(18)10(9)17)15(8)13(20)14-7-4-2-1-3-5-7/h1-5,8-12,16-18H,6H2,(H,14,20)/t8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | SYFSGYWNWOOWIO-RNWYCLNJSA-N |
| XLogP | -0.49 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|