C11H9Cl2N3OS — CID 110446996
1-(3,4-dichlorophenyl)-3-(1,3-thiazol-2-ylmethyl)urea (PubChem CID 110446996) has the molecular formula C11H9Cl2N3OS and a molecular weight of 302.19 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(1,3-thiazol-2-ylmethyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(1,3-thiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 110446996 |
| Molecular Formula | C11H9Cl2N3OS |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(1,3-thiazol-2-ylmethyl)urea |
| SMILES | O=C(NCc1nccs1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3OS/c12-8-2-1-7(5-9(8)13)16-11(17)15-6-10-14-3-4-18-10/h1-5H,6H2,(H2,15,16,17) |
| InChIKey | VRQIVXLYZNJTRS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |