C19H23NO2 — CID 11044705
(3R,5R)-5-[(2-methylpropan-2-yl)oxy]-2,3-diphenyl-1,2-oxazolidine (PubChem CID 11044705) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (3R,5R)-5-[(2-methylpropan-2-yl)oxy]-2,3-diphenyl-1,2-oxazolidine.
| Compound Name | (3R,5R)-5-[(2-methylpropan-2-yl)oxy]-2,3-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 11044705 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (3R,5R)-5-[(2-methylpropan-2-yl)oxy]-2,3-diphenyl-1,2-oxazolidine |
| SMILES | CC(C)(C)O[C@H]1C[C@H](c2ccccc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C19H23NO2/c1-19(2,3)21-18-14-17(15-10-6-4-7-11-15)20(22-18)16-12-8-5-9-13-16/h4-13,17-18H,14H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | SNTZBYMQRCSUQB-QZTJIDSGSA-N |
| XLogP | 4.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |