C14H10F3NO2S — CID 110447102
(E)-3-[2-methyl-4-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]but-2-enoic acid (PubChem CID 110447102) has the molecular formula C14H10F3NO2S and a molecular weight of 313.30 g/mol. Its IUPAC name is (E)-3-[2-methyl-4-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]but-2-enoic acid.
| Compound Name | (E)-3-[2-methyl-4-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 110447102 |
| Molecular Formula | C14H10F3NO2S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (E)-3-[2-methyl-4-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)c1sc(C)nc1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H10F3NO2S/c1-6(5-10(19)20)14-13(18-7(2)21-14)8-3-4-9(15)12(17)11(8)16/h3-5H,1-2H3,(H,19,20)/b6-5+ |
| InChIKey | NEHOOBIUTRUNHX-AATRIKPKSA-N |
| XLogP | 4.02 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|