C15H20N4O2S — CID 110447209
methyl (E)-3-[2-(methylamino)-4-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazol-5-yl]but-2-enoate (PubChem CID 110447209) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is methyl (E)-3-[2-(methylamino)-4-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazol-5-yl]but-2-enoate.
| Compound Name | methyl (E)-3-[2-(methylamino)-4-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazol-5-yl]but-2-enoate |
|---|---|
| PubChem CID | 110447209 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | methyl (E)-3-[2-(methylamino)-4-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazol-5-yl]but-2-enoate |
| SMILES | CNc1nc(-c2c(C)nn(C)c2C)c(/C(C)=C/C(=O)OC)s1 |
| InChI | InChI=1S/C15H20N4O2S/c1-8(7-11(20)21-6)14-13(17-15(16-4)22-14)12-9(2)18-19(5)10(12)3/h7H,1-6H3,(H,16,17)/b8-7+ |
| InChIKey | KHSAYSDDYJTJRE-BQYQJAHWSA-N |
| XLogP | 2.78 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|