C16H12F4O2 — CID 110447449
3-[4-fluoro-3-(2,3,4-trifluorophenyl)phenyl]butanoic acid (PubChem CID 110447449) has the molecular formula C16H12F4O2 and a molecular weight of 312.26 g/mol. Its IUPAC name is 3-[4-fluoro-3-(2,3,4-trifluorophenyl)phenyl]butanoic acid.
| Compound Name | 3-[4-fluoro-3-(2,3,4-trifluorophenyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 110447449 |
| Molecular Formula | C16H12F4O2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-[4-fluoro-3-(2,3,4-trifluorophenyl)phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(F)c(-c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H12F4O2/c1-8(6-14(21)22)9-2-4-12(17)11(7-9)10-3-5-13(18)16(20)15(10)19/h2-5,7-8H,6H2,1H3,(H,21,22) |
| InChIKey | SJERNLSIBBEFEG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|