About 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid
3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid (PubChem CID 110447463) has the molecular formula C17H22N2O2S
and a molecular weight of 318.44 g/mol. Its IUPAC name is 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid |
| PubChem CID | 110447463 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid |
| SMILES | Cc1nc(-c2ccccc2CN(C)C)c(C(C)CC(=O)O)s1 |
| InChI | InChI=1S/C17H22N2O2S/c1-11(9-15(20)21)17-16(18-12(2)22-17)14-8-6-5-7-13(14)10-19(3)4/h5-8,11H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | NSQNPUVUSFCIPM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid?
The IUPAC name of 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid (CID 110447463) is 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid.
What is the SMILES notation for 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid?
The canonical SMILES for 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid is Cc1nc(-c2ccccc2CN(C)C)c(C(C)CC(=O)O)s1.
What is the InChIKey of 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid?
The InChIKey is NSQNPUVUSFCIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2S/c1-11(9-15(20)21)17-16(18-12(2)22-17)14-8-6-5-7-13(14)10-19(3)4/h5-8,11H,9-10H2,1-4H3,(H,20,21).
What are the key properties of 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid?
3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid has a molecular weight of 318.44 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-[(dimethylamino)methyl]phenyl]-2-methyl-1,3-thiazol-5-yl]butanoic acid is sourced from PubChem (CID 110447463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).