C21H23NO3 — CID 110447520
4-[4-(1-acetyl-2,3-dihydroindol-5-yl)phenyl]-3-methylbutanoic acid (PubChem CID 110447520) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[4-(1-acetyl-2,3-dihydroindol-5-yl)phenyl]-3-methylbutanoic acid.
| Compound Name | 4-[4-(1-acetyl-2,3-dihydroindol-5-yl)phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 110447520 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-[4-(1-acetyl-2,3-dihydroindol-5-yl)phenyl]-3-methylbutanoic acid |
| SMILES | CC(=O)N1CCc2cc(-c3ccc(CC(C)CC(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C21H23NO3/c1-14(12-21(24)25)11-16-3-5-17(6-4-16)18-7-8-20-19(13-18)9-10-22(20)15(2)23/h3-8,13-14H,9-12H2,1-2H3,(H,24,25) |
| InChIKey | ROALOOFMBMNRGK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |