C16H21N3O2S — CID 110447953
(NE)-N-[1-[4-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethylidene]hydroxylamine (PubChem CID 110447953) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is (NE)-N-[1-[4-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[4-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 110447953 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (NE)-N-[1-[4-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1sc(C)nc1-c1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-11(18-20)16-15(17-12(2)22-16)13-5-7-14(8-6-13)21-10-9-19(3)4/h5-8,20H,9-10H2,1-4H3/b18-11+ |
| InChIKey | YXZSNFFZESEFIT-WOJGMQOQSA-N |
| XLogP | 3.26 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|