About 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile
6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile (PubChem CID 110448037) has the molecular formula C15H13N3OS
and a molecular weight of 283.36 g/mol. Its IUPAC name is 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile |
| PubChem CID | 110448037 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile |
| SMILES | Cc1ccc2c(c1)C(C#N)N(CCc1nccs1)C2=O |
| InChI | InChI=1S/C15H13N3OS/c1-10-2-3-11-12(8-10)13(9-16)18(15(11)19)6-4-14-17-5-7-20-14/h2-3,5,7-8,13H,4,6H2,1H3 |
| InChIKey | LCOGOPSDPFANDQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile?
The IUPAC name of 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile (CID 110448037) is 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile.
What is the SMILES notation for 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile?
The canonical SMILES for 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile is Cc1ccc2c(c1)C(C#N)N(CCc1nccs1)C2=O.
What is the InChIKey of 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile?
The InChIKey is LCOGOPSDPFANDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3OS/c1-10-2-3-11-12(8-10)13(9-16)18(15(11)19)6-4-14-17-5-7-20-14/h2-3,5,7-8,13H,4,6H2,1H3.
What are the key properties of 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile?
6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile has a molecular weight of 283.36 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-oxo-2-[2-(1,3-thiazol-2-yl)ethyl]-1H-isoindole-1-carbonitrile is sourced from PubChem (CID 110448037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).