About 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile
2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile (PubChem CID 110448981) has the molecular formula C15H18N2O5
and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile |
| PubChem CID | 110448981 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile |
| SMILES | COc1cc(OC)c2c(c1)C(=O)N(CC(OC)OC)C2C#N |
| InChI | InChI=1S/C15H18N2O5/c1-19-9-5-10-14(12(6-9)20-2)11(7-16)17(15(10)18)8-13(21-3)22-4/h5-6,11,13H,8H2,1-4H3 |
| InChIKey | OUMQNMRJAZGDTO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
The IUPAC name of 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile (CID 110448981) is 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile.
What is the SMILES notation for 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
The canonical SMILES for 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile is COc1cc(OC)c2c(c1)C(=O)N(CC(OC)OC)C2C#N.
What is the InChIKey of 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
The InChIKey is OUMQNMRJAZGDTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5/c1-19-9-5-10-14(12(6-9)20-2)11(7-16)17(15(10)18)8-13(21-3)22-4/h5-6,11,13H,8H2,1-4H3.
What are the key properties of 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile has a molecular weight of 306.32 g/mol, XLogP of 1.34, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethyl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile is sourced from PubChem (CID 110448981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).