About 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile
2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile (PubChem CID 110449005) has the molecular formula C15H16N2O5S
and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile |
| PubChem CID | 110449005 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile |
| SMILES | COc1cc(OC)c2c(c1)C(=O)N(C1CCS(=O)(=O)C1)C2C#N |
| InChI | InChI=1S/C15H16N2O5S/c1-21-10-5-11-14(13(6-10)22-2)12(7-16)17(15(11)18)9-3-4-23(19,20)8-9/h5-6,9,12H,3-4,8H2,1-2H3 |
| InChIKey | JMQGJYTXOUFBSP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile (CID 110449005) is 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile is COc1cc(OC)c2c(c1)C(=O)N(C1CCS(=O)(=O)C1)C2C#N.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
The InChIKey is JMQGJYTXOUFBSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O5S/c1-21-10-5-11-14(13(6-10)22-2)12(7-16)17(15(11)18)9-3-4-23(19,20)8-9/h5-6,9,12H,3-4,8H2,1-2H3.
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile?
2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile has a molecular weight of 336.37 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-5,7-dimethoxy-3-oxo-1H-isoindole-1-carbonitrile is sourced from PubChem (CID 110449005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).