About 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline
4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline (PubChem CID 110449763) has the molecular formula C22H25N3
and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline |
| PubChem CID | 110449763 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CN2Cc3c(ccc4ccccc34)C2CN)cc1 |
| InChI | InChI=1S/C22H25N3/c1-24(2)18-10-7-16(8-11-18)14-25-15-21-19-6-4-3-5-17(19)9-12-20(21)22(25)13-23/h3-12,22H,13-15,23H2,1-2H3 |
| InChIKey | OCJIJGVNUMSISR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline?
The IUPAC name of 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline (CID 110449763) is 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline is CN(C)c1ccc(CN2Cc3c(ccc4ccccc34)C2CN)cc1.
What is the InChIKey of 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline?
The InChIKey is OCJIJGVNUMSISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3/c1-24(2)18-10-7-16(8-11-18)14-25-15-21-19-6-4-3-5-17(19)9-12-20(21)22(25)13-23/h3-12,22H,13-15,23H2,1-2H3.
What are the key properties of 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline?
4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline has a molecular weight of 331.46 g/mol, XLogP of 3.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(aminomethyl)-1,3-dihydrobenzo[e]isoindol-2-yl]methyl]-N,N-dimethylaniline is sourced from PubChem (CID 110449763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).