C17H16F4N2 — CID 110449781
[4,5,6-trifluoro-2-[2-(4-fluorophenyl)ethyl]-1,3-dihydroisoindol-1-yl]methanamine (PubChem CID 110449781) has the molecular formula C17H16F4N2 and a molecular weight of 324.32 g/mol. Its IUPAC name is [4,5,6-trifluoro-2-[2-(4-fluorophenyl)ethyl]-1,3-dihydroisoindol-1-yl]methanamine.
| Compound Name | [4,5,6-trifluoro-2-[2-(4-fluorophenyl)ethyl]-1,3-dihydroisoindol-1-yl]methanamine |
|---|---|
| PubChem CID | 110449781 |
| Molecular Formula | C17H16F4N2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [4,5,6-trifluoro-2-[2-(4-fluorophenyl)ethyl]-1,3-dihydroisoindol-1-yl]methanamine |
| SMILES | NCC1c2cc(F)c(F)c(F)c2CN1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16F4N2/c18-11-3-1-10(2-4-11)5-6-23-9-13-12(15(23)8-22)7-14(19)17(21)16(13)20/h1-4,7,15H,5-6,8-9,22H2 |
| InChIKey | WMRAHXVEYLCQOR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|