About 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol
5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol (PubChem CID 110450025) has the molecular formula C14H20Cl2N2O
and a molecular weight of 303.23 g/mol. Its IUPAC name is 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol |
| PubChem CID | 110450025 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol |
| SMILES | NCC1c2cc(Cl)cc(Cl)c2CN1CCCCCO |
| InChI | InChI=1S/C14H20Cl2N2O/c15-10-6-11-12(13(16)7-10)9-18(14(11)8-17)4-2-1-3-5-19/h6-7,14,19H,1-5,8-9,17H2 |
| InChIKey | GOQPBFQNHLBYCR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol?
The IUPAC name of 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol (CID 110450025) is 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol.
What is the SMILES notation for 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol?
The canonical SMILES for 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol is NCC1c2cc(Cl)cc(Cl)c2CN1CCCCCO.
What is the InChIKey of 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol?
The InChIKey is GOQPBFQNHLBYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2N2O/c15-10-6-11-12(13(16)7-10)9-18(14(11)8-17)4-2-1-3-5-19/h6-7,14,19H,1-5,8-9,17H2.
What are the key properties of 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol?
5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol has a molecular weight of 303.23 g/mol, XLogP of 2.97, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(aminomethyl)-4,6-dichloro-1,3-dihydroisoindol-2-yl]pentan-1-ol is sourced from PubChem (CID 110450025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).