C18H28O4 — CID 11045055
(1S,2S,6R,7R,9R)-9-(2-methoxyethoxymethoxy)-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one (PubChem CID 11045055) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (1S,2S,6R,7R,9R)-9-(2-methoxyethoxymethoxy)-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one.
| Compound Name | (1S,2S,6R,7R,9R)-9-(2-methoxyethoxymethoxy)-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one |
|---|---|
| PubChem CID | 11045055 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (1S,2S,6R,7R,9R)-9-(2-methoxyethoxymethoxy)-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one |
| SMILES | COCCOCO[C@H]1C(=O)[C@@H]2C=C[C@@]1(C)[C@H]1CC(C)(C)C[C@@H]21 |
| InChI | InChI=1S/C18H28O4/c1-17(2)9-13-12-5-6-18(3,14(13)10-17)16(15(12)19)22-11-21-8-7-20-4/h5-6,12-14,16H,7-11H2,1-4H3/t12-,13+,14+,16+,18+/m1/s1 |
| InChIKey | XSGJSYWDDQKNAF-PEEYHIECSA-N |
| XLogP | 2.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|