C19H34O3 — CID 11045135
(E)-5,5-diethoxy-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-2-en-1-ol (PubChem CID 11045135) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (E)-5,5-diethoxy-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-2-en-1-ol.
| Compound Name | (E)-5,5-diethoxy-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-2-en-1-ol |
|---|---|
| PubChem CID | 11045135 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (E)-5,5-diethoxy-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-2-en-1-ol |
| SMILES | CCOC(C/C(C)=C/C(O)C1=C(C)CCCC1(C)C)OCC |
| InChI | InChI=1S/C19H34O3/c1-7-21-17(22-8-2)13-14(3)12-16(20)18-15(4)10-9-11-19(18,5)6/h12,16-17,20H,7-11,13H2,1-6H3/b14-12+ |
| InChIKey | QMGHXYZXZIRTGV-WYMLVPIESA-N |
| XLogP | 4.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|