C17H17N3O5 — CID 110452010
2-[[4-[(2-amino-4-methoxybenzoyl)amino]benzoyl]amino]acetic acid (PubChem CID 110452010) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-methoxybenzoyl)amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[(2-amino-4-methoxybenzoyl)amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 110452010 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-[[4-[(2-amino-4-methoxybenzoyl)amino]benzoyl]amino]acetic acid |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)NCC(=O)O)cc2)c(N)c1 |
| InChI | InChI=1S/C17H17N3O5/c1-25-12-6-7-13(14(18)8-12)17(24)20-11-4-2-10(3-5-11)16(23)19-9-15(21)22/h2-8H,9,18H2,1H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | GFTMTTJPNDACLB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|