C18H20FN3O3 — CID 110452130
N-[4-[2-[acetyl(methyl)amino]ethoxy]phenyl]-2-amino-5-fluorobenzamide (PubChem CID 110452130) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is N-[4-[2-[acetyl(methyl)amino]ethoxy]phenyl]-2-amino-5-fluorobenzamide.
| Compound Name | N-[4-[2-[acetyl(methyl)amino]ethoxy]phenyl]-2-amino-5-fluorobenzamide |
|---|---|
| PubChem CID | 110452130 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[4-[2-[acetyl(methyl)amino]ethoxy]phenyl]-2-amino-5-fluorobenzamide |
| SMILES | CC(=O)N(C)CCOc1ccc(NC(=O)c2cc(F)ccc2N)cc1 |
| InChI | InChI=1S/C18H20FN3O3/c1-12(23)22(2)9-10-25-15-6-4-14(5-7-15)21-18(24)16-11-13(19)3-8-17(16)20/h3-8,11H,9-10,20H2,1-2H3,(H,21,24) |
| InChIKey | HERNKAVENSWBRI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|