C17H18N2O4 — CID 110453092
ethyl 5-[(4-methoxycarbonylphenyl)methylamino]pyridine-3-carboxylate (PubChem CID 110453092) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is ethyl 5-[(4-methoxycarbonylphenyl)methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[(4-methoxycarbonylphenyl)methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 110453092 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethyl 5-[(4-methoxycarbonylphenyl)methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(NCc2ccc(C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C17H18N2O4/c1-3-23-17(21)14-8-15(11-18-10-14)19-9-12-4-6-13(7-5-12)16(20)22-2/h4-8,10-11,19H,3,9H2,1-2H3 |
| InChIKey | IXQKZZZRHNVGJH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |