C17H16N6 — CID 110453184
N-[1H-indol-3-yl-(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine (PubChem CID 110453184) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is N-[1H-indol-3-yl-(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine.
| Compound Name | N-[1H-indol-3-yl-(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110453184 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[1H-indol-3-yl-(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine |
| SMILES | Cn1cc(C(Nc2ccncn2)c2c[nH]c3ccccc23)cn1 |
| InChI | InChI=1S/C17H16N6/c1-23-10-12(8-21-23)17(22-16-6-7-18-11-20-16)14-9-19-15-5-3-2-4-13(14)15/h2-11,17,19H,1H3,(H,18,20,22) |
| InChIKey | DCJYEMBZSQEPCZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |