C20H30O3 — CID 11045380
(1S,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,9-dimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one (PubChem CID 11045380) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,9-dimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one.
| Compound Name | (1S,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,9-dimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one |
|---|---|
| PubChem CID | 11045380 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,9-dimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one |
| SMILES | C[C@]12C=C[C@@H]3CC(=O)C[C@](C)(CCCC4OCCO4)[C@@]3(CC1)C2 |
| InChI | InChI=1S/C20H30O3/c1-18-7-5-15-12-16(21)13-19(2,20(15,14-18)9-8-18)6-3-4-17-22-10-11-23-17/h5,7,15,17H,3-4,6,8-14H2,1-2H3/t15-,18+,19+,20+/m1/s1 |
| InChIKey | HWOYWHQMLRWBBI-TTYHFUOFSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|