C13H10FNO4S — CID 110453860
2-fluoro-5-(4-sulfamoylphenyl)benzoic acid (PubChem CID 110453860) has the molecular formula C13H10FNO4S and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-fluoro-5-(4-sulfamoylphenyl)benzoic acid.
| Compound Name | 2-fluoro-5-(4-sulfamoylphenyl)benzoic acid |
|---|---|
| PubChem CID | 110453860 |
| Molecular Formula | C13H10FNO4S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-fluoro-5-(4-sulfamoylphenyl)benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(F)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C13H10FNO4S/c14-12-6-3-9(7-11(12)13(16)17)8-1-4-10(5-2-8)20(15,18)19/h1-7H,(H,16,17)(H2,15,18,19) |
| InChIKey | WZVWRDLNVIWCKE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |